C28H26Cl2N2O8 — CID 10145112
4-nitrooxybutyl (E)-3-[4-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxy-3-methoxyphenyl]prop-2-enoate (PubChem CID 10145112) has the molecular formula C28H26Cl2N2O8 and a molecular weight of 589.43 g/mol. Its IUPAC name is 4-nitrooxybutyl (E)-3-[4-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxy-3-methoxyphenyl]prop-2-enoate.
| Compound Name | 4-nitrooxybutyl (E)-3-[4-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxy-3-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 10145112 |
| Molecular Formula | C28H26Cl2N2O8 |
| Molecular Weight | 589.43 g/mol |
| Exact Mass | 588.11 |
| IUPAC Name | 4-nitrooxybutyl (E)-3-[4-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxy-3-methoxyphenyl]prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCCCCO[N+](=O)[O-])ccc1OC(=O)Cc1ccccc1Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C28H26Cl2N2O8/c1-37-25-17-19(12-14-26(33)38-15-4-5-16-39-32(35)36)11-13-24(25)40-27(34)18-20-7-2-3-10-23(20)31-28-21(29)8-6-9-22(28)30/h2-3,6-14,17,31H,4-5,15-16,18H2,1H3/b14-12+ |
| InChIKey | CJBULXOCDKQOAS-WYMLVPIESA-N |
| XLogP | 6.44 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.43 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|