C33H43ClN2O11 — CID 54671815
[2-methoxy-4-[(E)-3-(5-nitrooxypentoxy)-3-oxoprop-1-enyl]phenyl] 2-[1-(2-morpholin-4-ylacetyl)oxypentyl]benzoate;hydrochloride (PubChem CID 54671815) has the molecular formula C33H43ClN2O11 and a molecular weight of 679.16 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-3-(5-nitrooxypentoxy)-3-oxoprop-1-enyl]phenyl] 2-[1-(2-morpholin-4-ylacetyl)oxypentyl]benzoate;hydrochloride.
| Compound Name | [2-methoxy-4-[(E)-3-(5-nitrooxypentoxy)-3-oxoprop-1-enyl]phenyl] 2-[1-(2-morpholin-4-ylacetyl)oxypentyl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 54671815 |
| Molecular Formula | C33H43ClN2O11 |
| Molecular Weight | 679.16 g/mol |
| Exact Mass | 678.26 |
| IUPAC Name | [2-methoxy-4-[(E)-3-(5-nitrooxypentoxy)-3-oxoprop-1-enyl]phenyl] 2-[1-(2-morpholin-4-ylacetyl)oxypentyl]benzoate;hydrochloride |
| SMILES | CCCCC(OC(=O)CN1CCOCC1)c1ccccc1C(=O)Oc1ccc(/C=C/C(=O)OCCCCCO[N+](=O)[O-])cc1OC.Cl |
| InChI | InChI=1S/C33H42N2O11.ClH/c1-3-4-12-28(45-32(37)24-34-17-21-42-22-18-34)26-10-6-7-11-27(26)33(38)46-29-15-13-25(23-30(29)41-2)14-16-31(36)43-19-8-5-9-20-44-35(39)40;/h6-7,10-11,13-16,23,28H,3-5,8-9,12,17-22,24H2,1-2H3;1H/b16-14+; |
| InChIKey | RHYDUINTIQGFHW-BACBYAOASA-N |
| XLogP | 5.38 |
| TPSA | 152.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.16 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|