C23H23BrO7 — CID 68925882
[4-[(E)-3-(4-bromobutoxy)-3-oxoprop-1-enyl]-2-methoxyphenyl] 2-acetyloxybenzoate (PubChem CID 68925882) has the molecular formula C23H23BrO7 and a molecular weight of 491.33 g/mol. Its IUPAC name is [4-[(E)-3-(4-bromobutoxy)-3-oxoprop-1-enyl]-2-methoxyphenyl] 2-acetyloxybenzoate.
| Compound Name | [4-[(E)-3-(4-bromobutoxy)-3-oxoprop-1-enyl]-2-methoxyphenyl] 2-acetyloxybenzoate |
|---|---|
| PubChem CID | 68925882 |
| Molecular Formula | C23H23BrO7 |
| Molecular Weight | 491.33 g/mol |
| Exact Mass | 490.06 |
| IUPAC Name | [4-[(E)-3-(4-bromobutoxy)-3-oxoprop-1-enyl]-2-methoxyphenyl] 2-acetyloxybenzoate |
| SMILES | COc1cc(/C=C/C(=O)OCCCCBr)ccc1OC(=O)c1ccccc1OC(C)=O |
| InChI | InChI=1S/C23H23BrO7/c1-16(25)30-19-8-4-3-7-18(19)23(27)31-20-11-9-17(15-21(20)28-2)10-12-22(26)29-14-6-5-13-24/h3-4,7-12,15H,5-6,13-14H2,1-2H3/b12-10+ |
| InChIKey | ZMFDJTCWSUIIOR-ZRDIBKRKSA-N |
| XLogP | 4.57 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.33 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|