C21H22N2O9 — CID 85041314
[2-methoxy-4-[3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]phenyl] 5-amino-2-hydroxybenzoate (PubChem CID 85041314) has the molecular formula C21H22N2O9 and a molecular weight of 446.41 g/mol. Its IUPAC name is [2-methoxy-4-[3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]phenyl] 5-amino-2-hydroxybenzoate.
| Compound Name | [2-methoxy-4-[3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]phenyl] 5-amino-2-hydroxybenzoate |
|---|---|
| PubChem CID | 85041314 |
| Molecular Formula | C21H22N2O9 |
| Molecular Weight | 446.41 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | [2-methoxy-4-[3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]phenyl] 5-amino-2-hydroxybenzoate |
| SMILES | COc1cc(C=CC(=O)OCCCCO[N+](=O)[O-])ccc1OC(=O)c1cc(N)ccc1O |
| InChI | InChI=1S/C21H22N2O9/c1-29-19-12-14(5-9-20(25)30-10-2-3-11-31-23(27)28)4-8-18(19)32-21(26)16-13-15(22)6-7-17(16)24/h4-9,12-13,24H,2-3,10-11,22H2,1H3 |
| InChIKey | HNWAURQUQLLQEP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 160.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|