C23H24N4O8S3 — CID 143690739
5-amino-3H-1,3,4-thiadiazole-2-thione;[2-methoxy-4-[(E)-3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]phenyl] 4-sulfanylbenzoate (PubChem CID 143690739) has the molecular formula C23H24N4O8S3 and a molecular weight of 580.67 g/mol. Its IUPAC name is 5-amino-3H-1,3,4-thiadiazole-2-thione;[2-methoxy-4-[(E)-3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]phenyl] 4-sulfanylbenzoate.
| Compound Name | 5-amino-3H-1,3,4-thiadiazole-2-thione;[2-methoxy-4-[(E)-3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]phenyl] 4-sulfanylbenzoate |
|---|---|
| PubChem CID | 143690739 |
| Molecular Formula | C23H24N4O8S3 |
| Molecular Weight | 580.67 g/mol |
| Exact Mass | 580.08 |
| IUPAC Name | 5-amino-3H-1,3,4-thiadiazole-2-thione;[2-methoxy-4-[(E)-3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]phenyl] 4-sulfanylbenzoate |
| SMILES | COc1cc(/C=C/C(=O)OCCCCO[N+](=O)[O-])ccc1OC(=O)c1ccc(S)cc1.Nc1n[nH]c(=S)s1 |
| InChI | InChI=1S/C21H21NO8S.C2H3N3S2/c1-27-19-14-15(5-11-20(23)28-12-2-3-13-29-22(25)26)4-10-18(19)30-21(24)16-6-8-17(31)9-7-16;3-1-4-5-2(6)7-1/h4-11,14,31H,2-3,12-13H2,1H3;(H2,3,4)(H,5,6)/b11-5+; |
| InChIKey | XYTLHJQVXMPGTC-HMXKFKBXSA-N |
| XLogP | 4.53 |
| TPSA | 168.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.67 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|