C24H34N2O10 — CID 68578801
[2-methoxy-4-[(E)-3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]phenyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (PubChem CID 68578801) has the molecular formula C24H34N2O10 and a molecular weight of 510.54 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]phenyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
| Compound Name | [2-methoxy-4-[(E)-3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]phenyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 68578801 |
| Molecular Formula | C24H34N2O10 |
| Molecular Weight | 510.54 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | [2-methoxy-4-[(E)-3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]phenyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| SMILES | CCCC(NC(=O)OC(C)(C)C)C(=O)Oc1ccc(/C=C/C(=O)OCCCCO[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C24H34N2O10/c1-6-9-18(25-23(29)36-24(2,3)4)22(28)35-19-12-10-17(16-20(19)32-5)11-13-21(27)33-14-7-8-15-34-26(30)31/h10-13,16,18H,6-9,14-15H2,1-5H3,(H,25,29)/b13-11+ |
| InChIKey | AXXUKBGPDZUGAD-ACCUITESSA-N |
| XLogP | 3.84 |
| TPSA | 152.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.54 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|