C29H28FNO8 — CID 68921029
[2-methoxy-4-[3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]phenyl] 2-fluoro-2-(2-phenylphenyl)propanoate (PubChem CID 68921029) has the molecular formula C29H28FNO8 and a molecular weight of 537.54 g/mol. Its IUPAC name is [2-methoxy-4-[3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]phenyl] 2-fluoro-2-(2-phenylphenyl)propanoate.
| Compound Name | [2-methoxy-4-[3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]phenyl] 2-fluoro-2-(2-phenylphenyl)propanoate |
|---|---|
| PubChem CID | 68921029 |
| Molecular Formula | C29H28FNO8 |
| Molecular Weight | 537.54 g/mol |
| Exact Mass | 537.18 |
| IUPAC Name | [2-methoxy-4-[3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]phenyl] 2-fluoro-2-(2-phenylphenyl)propanoate |
| SMILES | COc1cc(C=CC(=O)OCCCCO[N+](=O)[O-])ccc1OC(=O)C(C)(F)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C29H28FNO8/c1-29(30,24-13-7-6-12-23(24)22-10-4-3-5-11-22)28(33)39-25-16-14-21(20-26(25)36-2)15-17-27(32)37-18-8-9-19-38-31(34)35/h3-7,10-17,20H,8-9,18-19H2,1-2H3 |
| InChIKey | XNNOTUBAWZUJDN-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.54 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|