C28H29NO9 — CID 69039161
[2-methoxy-4-[(E)-3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]phenyl] (2S)-2-(6-methoxynaphthalen-2-yl)propanoate (PubChem CID 69039161) has the molecular formula C28H29NO9 and a molecular weight of 523.54 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]phenyl] (2S)-2-(6-methoxynaphthalen-2-yl)propanoate.
| Compound Name | [2-methoxy-4-[(E)-3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]phenyl] (2S)-2-(6-methoxynaphthalen-2-yl)propanoate |
|---|---|
| PubChem CID | 69039161 |
| Molecular Formula | C28H29NO9 |
| Molecular Weight | 523.54 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | [2-methoxy-4-[(E)-3-(4-nitrooxybutoxy)-3-oxoprop-1-enyl]phenyl] (2S)-2-(6-methoxynaphthalen-2-yl)propanoate |
| SMILES | COc1ccc2cc([C@H](C)C(=O)Oc3ccc(/C=C/C(=O)OCCCCO[N+](=O)[O-])cc3OC)ccc2c1 |
| InChI | InChI=1S/C28H29NO9/c1-19(21-8-9-23-18-24(34-2)11-10-22(23)17-21)28(31)38-25-12-6-20(16-26(25)35-3)7-13-27(30)36-14-4-5-15-37-29(32)33/h6-13,16-19H,4-5,14-15H2,1-3H3/b13-7+/t19-/m0/s1 |
| InChIKey | CYNDZDAAMFCRGK-KRSRXSRCSA-N |
| XLogP | 5.11 |
| TPSA | 123.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.54 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|