C18H21N3O6 — CID 73081355
[4-[2-[2-(6-methoxynaphthalen-2-yl)propanoyl]hydrazinyl]-4-oxobutyl] nitrate (PubChem CID 73081355) has the molecular formula C18H21N3O6 and a molecular weight of 375.38 g/mol. Its IUPAC name is [4-[2-[2-(6-methoxynaphthalen-2-yl)propanoyl]hydrazinyl]-4-oxobutyl] nitrate.
| Compound Name | [4-[2-[2-(6-methoxynaphthalen-2-yl)propanoyl]hydrazinyl]-4-oxobutyl] nitrate |
|---|---|
| PubChem CID | 73081355 |
| Molecular Formula | C18H21N3O6 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | [4-[2-[2-(6-methoxynaphthalen-2-yl)propanoyl]hydrazinyl]-4-oxobutyl] nitrate |
| SMILES | COc1ccc2cc(C(C)C(=O)NNC(=O)CCCO[N+](=O)[O-])ccc2c1 |
| InChI | InChI=1S/C18H21N3O6/c1-12(18(23)20-19-17(22)4-3-9-27-21(24)25)13-5-6-15-11-16(26-2)8-7-14(15)10-13/h5-8,10-12H,3-4,9H2,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | LZBHZFUQPUJUGK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|