C23H28N2O8S — CID 87843932
4-nitrooxybutyl (2S)-2-acetamido-3-[(2S)-2-(6-methoxynaphthalen-2-yl)propanoyl]sulfanylpropanoate (PubChem CID 87843932) has the molecular formula C23H28N2O8S and a molecular weight of 492.55 g/mol. Its IUPAC name is 4-nitrooxybutyl (2S)-2-acetamido-3-[(2S)-2-(6-methoxynaphthalen-2-yl)propanoyl]sulfanylpropanoate.
| Compound Name | 4-nitrooxybutyl (2S)-2-acetamido-3-[(2S)-2-(6-methoxynaphthalen-2-yl)propanoyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 87843932 |
| Molecular Formula | C23H28N2O8S |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | 4-nitrooxybutyl (2S)-2-acetamido-3-[(2S)-2-(6-methoxynaphthalen-2-yl)propanoyl]sulfanylpropanoate |
| SMILES | COc1ccc2cc([C@H](C)C(=O)SC[C@@H](NC(C)=O)C(=O)OCCCCO[N+](=O)[O-])ccc2c1 |
| InChI | InChI=1S/C23H28N2O8S/c1-15(17-6-7-19-13-20(31-3)9-8-18(19)12-17)23(28)34-14-21(24-16(2)26)22(27)32-10-4-5-11-33-25(29)30/h6-9,12-13,15,21H,4-5,10-11,14H2,1-3H3,(H,24,26)/t15-,21+/m0/s1 |
| InChIKey | RJMKXSJNPQNWDL-YCRPNKLZSA-N |
| XLogP | 3.25 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|