C19H24N2O4S — CID 91140988
2-(1-aminoethylamino)-3-[2-(6-methoxynaphthalen-2-yl)propanoylsulfanyl]propanoic acid (PubChem CID 91140988) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is 2-(1-aminoethylamino)-3-[2-(6-methoxynaphthalen-2-yl)propanoylsulfanyl]propanoic acid.
| Compound Name | 2-(1-aminoethylamino)-3-[2-(6-methoxynaphthalen-2-yl)propanoylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 91140988 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 2-(1-aminoethylamino)-3-[2-(6-methoxynaphthalen-2-yl)propanoylsulfanyl]propanoic acid |
| SMILES | COc1ccc2cc(C(C)C(=O)SCC(NC(C)N)C(=O)O)ccc2c1 |
| InChI | InChI=1S/C19H24N2O4S/c1-11(19(24)26-10-17(18(22)23)21-12(2)20)13-4-5-15-9-16(25-3)7-6-14(15)8-13/h4-9,11-12,17,21H,10,20H2,1-3H3,(H,22,23) |
| InChIKey | CSJBBDLFDXTCAM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|