C23H30N6O4S — CID 59487684
S-[2-acetamido-3-[[amino-[(E)-[amino(dimethylamino)methylidene]amino]methylidene]amino]-3-oxopropyl] (2R)-2-(6-methoxynaphthalen-2-yl)propanethioate (PubChem CID 59487684) has the molecular formula C23H30N6O4S and a molecular weight of 486.60 g/mol. Its IUPAC name is S-[2-acetamido-3-[[amino-[(E)-[amino(dimethylamino)methylidene]amino]methylidene]amino]-3-oxopropyl] (2R)-2-(6-methoxynaphthalen-2-yl)propanethioate.
| Compound Name | S-[2-acetamido-3-[[amino-[(E)-[amino(dimethylamino)methylidene]amino]methylidene]amino]-3-oxopropyl] (2R)-2-(6-methoxynaphthalen-2-yl)propanethioate |
|---|---|
| PubChem CID | 59487684 |
| Molecular Formula | C23H30N6O4S |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | S-[2-acetamido-3-[[amino-[(E)-[amino(dimethylamino)methylidene]amino]methylidene]amino]-3-oxopropyl] (2R)-2-(6-methoxynaphthalen-2-yl)propanethioate |
| SMILES | COc1ccc2cc([C@@H](C)C(=O)SCC(NC(C)=O)C(=O)/N=C(N)/N=C(\N)N(C)C)ccc2c1 |
| InChI | InChI=1S/C23H30N6O4S/c1-13(15-6-7-17-11-18(33-5)9-8-16(17)10-15)21(32)34-12-19(26-14(2)30)20(31)27-22(24)28-23(25)29(3)4/h6-11,13,19H,12H2,1-5H3,(H,26,30)(H4,24,25,27,28,31)/t13-,19?/m1/s1 |
| InChIKey | NIVKROVIGXMWQQ-BSOCMFCZSA-N |
| XLogP | 1.43 |
| TPSA | 152.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|