C19H27NO4S — CID 21271292
methyl 2-acetamido-3-[2-[4-(2-methylpropyl)phenyl]propanoylsulfanyl]propanoate (PubChem CID 21271292) has the molecular formula C19H27NO4S and a molecular weight of 365.50 g/mol. Its IUPAC name is methyl 2-acetamido-3-[2-[4-(2-methylpropyl)phenyl]propanoylsulfanyl]propanoate.
| Compound Name | methyl 2-acetamido-3-[2-[4-(2-methylpropyl)phenyl]propanoylsulfanyl]propanoate |
|---|---|
| PubChem CID | 21271292 |
| Molecular Formula | C19H27NO4S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | methyl 2-acetamido-3-[2-[4-(2-methylpropyl)phenyl]propanoylsulfanyl]propanoate |
| SMILES | COC(=O)C(CSC(=O)C(C)c1ccc(CC(C)C)cc1)NC(C)=O |
| InChI | InChI=1S/C19H27NO4S/c1-12(2)10-15-6-8-16(9-7-15)13(3)19(23)25-11-17(18(22)24-5)20-14(4)21/h6-9,12-13,17H,10-11H2,1-5H3,(H,20,21) |
| InChIKey | TXYFSDROCLOMFS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|