About S-methyl (2S)-2-[4-(2-methylpropyl)phenyl]propanethioate
S-methyl (2S)-2-[4-(2-methylpropyl)phenyl]propanethioate (PubChem CID 11276414) has the molecular formula C14H20OS
and a molecular weight of 236.38 g/mol. Its IUPAC name is S-methyl (2S)-2-[4-(2-methylpropyl)phenyl]propanethioate.
Molecular Properties
| Compound Name | S-methyl (2S)-2-[4-(2-methylpropyl)phenyl]propanethioate |
| PubChem CID | 11276414 |
| Molecular Formula | C14H20OS |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | S-methyl (2S)-2-[4-(2-methylpropyl)phenyl]propanethioate |
| SMILES | CSC(=O)[C@@H](C)c1ccc(CC(C)C)cc1 |
| InChI | InChI=1S/C14H20OS/c1-10(2)9-12-5-7-13(8-6-12)11(3)14(15)16-4/h5-8,10-11H,9H2,1-4H3/t11-/m0/s1 |
| InChIKey | ARZSXCRVRVKSCN-NSHDSACASA-N |
| XLogP | 3.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-methyl (2S)-2-[4-(2-methylpropyl)phenyl]propanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-methyl (2S)-2-[4-(2-methylpropyl)phenyl]propanethioate?
The IUPAC name of S-methyl (2S)-2-[4-(2-methylpropyl)phenyl]propanethioate (CID 11276414) is S-methyl (2S)-2-[4-(2-methylpropyl)phenyl]propanethioate.
What is the SMILES notation for S-methyl (2S)-2-[4-(2-methylpropyl)phenyl]propanethioate?
The canonical SMILES for S-methyl (2S)-2-[4-(2-methylpropyl)phenyl]propanethioate is CSC(=O)[C@@H](C)c1ccc(CC(C)C)cc1.
What is the InChIKey of S-methyl (2S)-2-[4-(2-methylpropyl)phenyl]propanethioate?
The InChIKey is ARZSXCRVRVKSCN-NSHDSACASA-N. The full InChI is InChI=1S/C14H20OS/c1-10(2)9-12-5-7-13(8-6-12)11(3)14(15)16-4/h5-8,10-11H,9H2,1-4H3/t11-/m0/s1.
What are the key properties of S-methyl (2S)-2-[4-(2-methylpropyl)phenyl]propanethioate?
S-methyl (2S)-2-[4-(2-methylpropyl)phenyl]propanethioate has a molecular weight of 236.38 g/mol, XLogP of 3.88, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-methyl (2S)-2-[4-(2-methylpropyl)phenyl]propanethioate is sourced from PubChem (CID 11276414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).