C24H32N6O4S — CID 123165139
S-[3-acetamido-4-[[amino-[[amino(dimethylamino)methylidene]amino]methylidene]amino]-4-oxobutyl] 2-(6-methoxynaphthalen-2-yl)propanethioate (PubChem CID 123165139) has the molecular formula C24H32N6O4S and a molecular weight of 500.63 g/mol. Its IUPAC name is S-[3-acetamido-4-[[amino-[[amino(dimethylamino)methylidene]amino]methylidene]amino]-4-oxobutyl] 2-(6-methoxynaphthalen-2-yl)propanethioate.
| Compound Name | S-[3-acetamido-4-[[amino-[[amino(dimethylamino)methylidene]amino]methylidene]amino]-4-oxobutyl] 2-(6-methoxynaphthalen-2-yl)propanethioate |
|---|---|
| PubChem CID | 123165139 |
| Molecular Formula | C24H32N6O4S |
| Molecular Weight | 500.63 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | S-[3-acetamido-4-[[amino-[[amino(dimethylamino)methylidene]amino]methylidene]amino]-4-oxobutyl] 2-(6-methoxynaphthalen-2-yl)propanethioate |
| SMILES | COc1ccc2cc(C(C)C(=O)SCCC(NC(C)=O)C(=O)/N=C(\N)N=C(N)N(C)C)ccc2c1 |
| InChI | InChI=1S/C24H32N6O4S/c1-14(16-6-7-18-13-19(34-5)9-8-17(18)12-16)22(33)35-11-10-20(27-15(2)31)21(32)28-23(25)29-24(26)30(3)4/h6-9,12-14,20H,10-11H2,1-5H3,(H,27,31)(H4,25,26,28,29,32) |
| InChIKey | IVMYKTRYLDOUGU-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 152.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.63 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|