C10H18N2O6S — CID 143078531
4-nitrooxybutyl 2-acetamido-3-methylsulfanylpropanoate (PubChem CID 143078531) has the molecular formula C10H18N2O6S and a molecular weight of 294.33 g/mol. Its IUPAC name is 4-nitrooxybutyl 2-acetamido-3-methylsulfanylpropanoate.
| Compound Name | 4-nitrooxybutyl 2-acetamido-3-methylsulfanylpropanoate |
|---|---|
| PubChem CID | 143078531 |
| Molecular Formula | C10H18N2O6S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 4-nitrooxybutyl 2-acetamido-3-methylsulfanylpropanoate |
| SMILES | CSCC(NC(C)=O)C(=O)OCCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C10H18N2O6S/c1-8(13)11-9(7-19-2)10(14)17-5-3-4-6-18-12(15)16/h9H,3-7H2,1-2H3,(H,11,13) |
| InChIKey | DHBBXKGIQRPFMD-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|