C9H15N3O8 — CID 89078958
4-amino-2-(4-nitrooxybutoxycarbonylamino)-4-oxobutanoic acid (PubChem CID 89078958) has the molecular formula C9H15N3O8 and a molecular weight of 293.23 g/mol. Its IUPAC name is 4-amino-2-(4-nitrooxybutoxycarbonylamino)-4-oxobutanoic acid.
| Compound Name | 4-amino-2-(4-nitrooxybutoxycarbonylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 89078958 |
| Molecular Formula | C9H15N3O8 |
| Molecular Weight | 293.23 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 4-amino-2-(4-nitrooxybutoxycarbonylamino)-4-oxobutanoic acid |
| SMILES | NC(=O)CC(NC(=O)OCCCCO[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C9H15N3O8/c10-7(13)5-6(8(14)15)11-9(16)19-3-1-2-4-20-12(17)18/h6H,1-5H2,(H2,10,13)(H,11,16)(H,14,15) |
| InChIKey | KNMBODFEXDQUPF-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 171.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.23 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|