About bis(4-nitrooxybutyl) (2S)-2-aminobutanedioate
bis(4-nitrooxybutyl) (2S)-2-aminobutanedioate (PubChem CID 58165121) has the molecular formula C12H21N3O10
and a molecular weight of 367.31 g/mol. Its IUPAC name is bis(4-nitrooxybutyl) (2S)-2-aminobutanedioate.
Molecular Properties
| Compound Name | bis(4-nitrooxybutyl) (2S)-2-aminobutanedioate |
| PubChem CID | 58165121 |
| Molecular Formula | C12H21N3O10 |
| Molecular Weight | 367.31 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | bis(4-nitrooxybutyl) (2S)-2-aminobutanedioate |
| SMILES | N[C@@H](CC(=O)OCCCCO[N+](=O)[O-])C(=O)OCCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C12H21N3O10/c13-10(12(17)23-6-2-4-8-25-15(20)21)9-11(16)22-5-1-3-7-24-14(18)19/h10H,1-9,13H2/t10-/m0/s1 |
| InChIKey | JOAADICTYQNPOM-JTQLQIEISA-N |
| XLogP | -0.23 |
| TPSA | 183.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.31 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(4-nitrooxybutyl) (2S)-2-aminobutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-nitrooxybutyl) (2S)-2-aminobutanedioate?
The IUPAC name of bis(4-nitrooxybutyl) (2S)-2-aminobutanedioate (CID 58165121) is bis(4-nitrooxybutyl) (2S)-2-aminobutanedioate.
What is the SMILES notation for bis(4-nitrooxybutyl) (2S)-2-aminobutanedioate?
The canonical SMILES for bis(4-nitrooxybutyl) (2S)-2-aminobutanedioate is N[C@@H](CC(=O)OCCCCO[N+](=O)[O-])C(=O)OCCCCO[N+](=O)[O-].
What is the InChIKey of bis(4-nitrooxybutyl) (2S)-2-aminobutanedioate?
The InChIKey is JOAADICTYQNPOM-JTQLQIEISA-N. The full InChI is InChI=1S/C12H21N3O10/c13-10(12(17)23-6-2-4-8-25-15(20)21)9-11(16)22-5-1-3-7-24-14(18)19/h10H,1-9,13H2/t10-/m0/s1.
What are the key properties of bis(4-nitrooxybutyl) (2S)-2-aminobutanedioate?
bis(4-nitrooxybutyl) (2S)-2-aminobutanedioate has a molecular weight of 367.31 g/mol, XLogP of -0.23, 15 rotatable bonds, 1 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-nitrooxybutyl) (2S)-2-aminobutanedioate is sourced from PubChem (CID 58165121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).