C7H15N3O5S — CID 59287675
2-(2-nitrooxyethylamino)ethyl 2-amino-3-sulfanylpropanoate (PubChem CID 59287675) has the molecular formula C7H15N3O5S and a molecular weight of 253.28 g/mol. Its IUPAC name is 2-(2-nitrooxyethylamino)ethyl 2-amino-3-sulfanylpropanoate.
| Compound Name | 2-(2-nitrooxyethylamino)ethyl 2-amino-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 59287675 |
| Molecular Formula | C7H15N3O5S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 2-(2-nitrooxyethylamino)ethyl 2-amino-3-sulfanylpropanoate |
| SMILES | NC(CS)C(=O)OCCNCCO[N+](=O)[O-] |
| InChI | InChI=1S/C7H15N3O5S/c8-6(5-16)7(11)14-3-1-9-2-4-15-10(12)13/h6,9,16H,1-5,8H2 |
| InChIKey | PWKZHMYXDNZBLF-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|