C12H32N6O4S2 — CID 118499019
N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;bis(2-amino-3-sulfanylpropanoic acid) (PubChem CID 118499019) has the molecular formula C12H32N6O4S2 and a molecular weight of 388.56 g/mol. Its IUPAC name is N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;bis(2-amino-3-sulfanylpropanoic acid).
| Compound Name | N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;bis(2-amino-3-sulfanylpropanoic acid) |
|---|---|
| PubChem CID | 118499019 |
| Molecular Formula | C12H32N6O4S2 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;bis(2-amino-3-sulfanylpropanoic acid) |
| SMILES | NC(CS)C(=O)O.NC(CS)C(=O)O.NCCNCCNCCN |
| InChI | InChI=1S/C6H18N4.2C3H7NO2S/c7-1-3-9-5-6-10-4-2-8;2*4-2(1-7)3(5)6/h9-10H,1-8H2;2*2,7H,1,4H2,(H,5,6) |
| InChIKey | CIFXFBBNXVYSKG-UHFFFAOYSA-N |
| XLogP | -3.26 |
| TPSA | 202.74 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | -3.26 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|