C6H13NO4S — CID 57042627
3,3-dihydroxypropyl (2R)-2-amino-3-sulfanylpropanoate (PubChem CID 57042627) has the molecular formula C6H13NO4S and a molecular weight of 195.24 g/mol. Its IUPAC name is 3,3-dihydroxypropyl (2R)-2-amino-3-sulfanylpropanoate.
| Compound Name | 3,3-dihydroxypropyl (2R)-2-amino-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 57042627 |
| Molecular Formula | C6H13NO4S |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 3,3-dihydroxypropyl (2R)-2-amino-3-sulfanylpropanoate |
| SMILES | N[C@@H](CS)C(=O)OCCC(O)O |
| InChI | InChI=1S/C6H13NO4S/c7-4(3-12)6(10)11-2-1-5(8)9/h4-5,8-9,12H,1-3,7H2/t4-/m0/s1 |
| InChIKey | YBKANLZLRMFKRQ-BYPYZUCNSA-N |
| XLogP | -1.51 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|