C6H11NO5S — CID 18977747
(2-amino-3-sulfanylpropanoyl) 2,3-dihydroxypropanoate (PubChem CID 18977747) has the molecular formula C6H11NO5S and a molecular weight of 209.22 g/mol. Its IUPAC name is (2-amino-3-sulfanylpropanoyl) 2,3-dihydroxypropanoate.
| Compound Name | (2-amino-3-sulfanylpropanoyl) 2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 18977747 |
| Molecular Formula | C6H11NO5S |
| Molecular Weight | 209.22 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | (2-amino-3-sulfanylpropanoyl) 2,3-dihydroxypropanoate |
| SMILES | NC(CS)C(=O)OC(=O)C(O)CO |
| InChI | InChI=1S/C6H11NO5S/c7-3(2-13)5(10)12-6(11)4(9)1-8/h3-4,8-9,13H,1-2,7H2 |
| InChIKey | WBVMBOAHFJMYDZ-UHFFFAOYSA-N |
| XLogP | -2.33 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.22 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|