About sodium;acetyl (2R)-2-amino-3-sulfanylpropanoate;hydride
sodium;acetyl (2R)-2-amino-3-sulfanylpropanoate;hydride (PubChem CID 173279188) has the molecular formula C5H10NNaO3S
and a molecular weight of 187.20 g/mol. Its IUPAC name is sodium;acetyl (2R)-2-amino-3-sulfanylpropanoate;hydride.
Molecular Properties
| Compound Name | sodium;acetyl (2R)-2-amino-3-sulfanylpropanoate;hydride |
| PubChem CID | 173279188 |
| Molecular Formula | C5H10NNaO3S |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.03 |
| IUPAC Name | sodium;acetyl (2R)-2-amino-3-sulfanylpropanoate;hydride |
| SMILES | CC(=O)OC(=O)[C@@H](N)CS.[H-].[Na+] |
| InChI | InChI=1S/C5H9NO3S.Na.H/c1-3(7)9-5(8)4(6)2-10;;/h4,10H,2,6H2,1H3;;/q;+1;-1/t4-;;/m0../s1 |
| InChIKey | RJPOPEYLCSLCMU-FHNDMYTFSA-N |
| XLogP | -3.55 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | -3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;acetyl (2R)-2-amino-3-sulfanylpropanoate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;acetyl (2R)-2-amino-3-sulfanylpropanoate;hydride?
The IUPAC name of sodium;acetyl (2R)-2-amino-3-sulfanylpropanoate;hydride (CID 173279188) is sodium;acetyl (2R)-2-amino-3-sulfanylpropanoate;hydride.
What is the SMILES notation for sodium;acetyl (2R)-2-amino-3-sulfanylpropanoate;hydride?
The canonical SMILES for sodium;acetyl (2R)-2-amino-3-sulfanylpropanoate;hydride is CC(=O)OC(=O)[C@@H](N)CS.[H-].[Na+].
What is the InChIKey of sodium;acetyl (2R)-2-amino-3-sulfanylpropanoate;hydride?
The InChIKey is RJPOPEYLCSLCMU-FHNDMYTFSA-N. The full InChI is InChI=1S/C5H9NO3S.Na.H/c1-3(7)9-5(8)4(6)2-10;;/h4,10H,2,6H2,1H3;;/q;+1;-1/t4-;;/m0../s1.
What are the key properties of sodium;acetyl (2R)-2-amino-3-sulfanylpropanoate;hydride?
sodium;acetyl (2R)-2-amino-3-sulfanylpropanoate;hydride has a molecular weight of 187.20 g/mol, XLogP of -3.55, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;acetyl (2R)-2-amino-3-sulfanylpropanoate;hydride is sourced from PubChem (CID 173279188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).