C13H25N3O7 — CID 59287757
2-amino-6-(6-nitrooxyhexoxycarbonylamino)hexanoic acid (PubChem CID 59287757) has the molecular formula C13H25N3O7 and a molecular weight of 335.36 g/mol. Its IUPAC name is 2-amino-6-(6-nitrooxyhexoxycarbonylamino)hexanoic acid.
| Compound Name | 2-amino-6-(6-nitrooxyhexoxycarbonylamino)hexanoic acid |
|---|---|
| PubChem CID | 59287757 |
| Molecular Formula | C13H25N3O7 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 2-amino-6-(6-nitrooxyhexoxycarbonylamino)hexanoic acid |
| SMILES | NC(CCCCNC(=O)OCCCCCCO[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C13H25N3O7/c14-11(12(17)18)7-3-4-8-15-13(19)22-9-5-1-2-6-10-23-16(20)21/h11H,1-10,14H2,(H,15,19)(H,17,18) |
| InChIKey | MJWLCPUJIHKBAW-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 154.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|