About 8-nitrooxyoctyl prop-2-enoate;hydrochloride
8-nitrooxyoctyl prop-2-enoate;hydrochloride (PubChem CID 141040606) has the molecular formula C11H20ClNO5
and a molecular weight of 281.74 g/mol. Its IUPAC name is 8-nitrooxyoctyl prop-2-enoate;hydrochloride.
Molecular Properties
| Compound Name | 8-nitrooxyoctyl prop-2-enoate;hydrochloride |
| PubChem CID | 141040606 |
| Molecular Formula | C11H20ClNO5 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 8-nitrooxyoctyl prop-2-enoate;hydrochloride |
| SMILES | C=CC(=O)OCCCCCCCCO[N+](=O)[O-].Cl |
| InChI | InChI=1S/C11H19NO5.ClH/c1-2-11(13)16-9-7-5-3-4-6-8-10-17-12(14)15;/h2H,1,3-10H2;1H |
| InChIKey | OUYNZBWZQQJDMZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-nitrooxyoctyl prop-2-enoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-nitrooxyoctyl prop-2-enoate;hydrochloride?
The IUPAC name of 8-nitrooxyoctyl prop-2-enoate;hydrochloride (CID 141040606) is 8-nitrooxyoctyl prop-2-enoate;hydrochloride.
What is the SMILES notation for 8-nitrooxyoctyl prop-2-enoate;hydrochloride?
The canonical SMILES for 8-nitrooxyoctyl prop-2-enoate;hydrochloride is C=CC(=O)OCCCCCCCCO[N+](=O)[O-].Cl.
What is the InChIKey of 8-nitrooxyoctyl prop-2-enoate;hydrochloride?
The InChIKey is OUYNZBWZQQJDMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO5.ClH/c1-2-11(13)16-9-7-5-3-4-6-8-10-17-12(14)15;/h2H,1,3-10H2;1H.
What are the key properties of 8-nitrooxyoctyl prop-2-enoate;hydrochloride?
8-nitrooxyoctyl prop-2-enoate;hydrochloride has a molecular weight of 281.74 g/mol, XLogP of 2.69, 11 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-nitrooxyoctyl prop-2-enoate;hydrochloride is sourced from PubChem (CID 141040606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).