C15H20N2O6 — CID 59287667
2-(6-nitrooxyhexanoylamino)-3-phenylpropanoic acid (PubChem CID 59287667) has the molecular formula C15H20N2O6 and a molecular weight of 324.33 g/mol. Its IUPAC name is 2-(6-nitrooxyhexanoylamino)-3-phenylpropanoic acid.
| Compound Name | 2-(6-nitrooxyhexanoylamino)-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 59287667 |
| Molecular Formula | C15H20N2O6 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 2-(6-nitrooxyhexanoylamino)-3-phenylpropanoic acid |
| SMILES | O=C(CCCCCO[N+](=O)[O-])NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C15H20N2O6/c18-14(9-5-2-6-10-23-17(21)22)16-13(15(19)20)11-12-7-3-1-4-8-12/h1,3-4,7-8,13H,2,5-6,9-11H2,(H,16,18)(H,19,20) |
| InChIKey | XOQGMPUEIPELRL-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|