C11H17N3O12S — CID 59287637
2-(3-nitrooxypropoxycarbonylamino)-3-(3-nitrooxypropoxycarbonylsulfanyl)propanoic acid (PubChem CID 59287637) has the molecular formula C11H17N3O12S and a molecular weight of 415.33 g/mol. Its IUPAC name is 2-(3-nitrooxypropoxycarbonylamino)-3-(3-nitrooxypropoxycarbonylsulfanyl)propanoic acid.
| Compound Name | 2-(3-nitrooxypropoxycarbonylamino)-3-(3-nitrooxypropoxycarbonylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 59287637 |
| Molecular Formula | C11H17N3O12S |
| Molecular Weight | 415.33 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | 2-(3-nitrooxypropoxycarbonylamino)-3-(3-nitrooxypropoxycarbonylsulfanyl)propanoic acid |
| SMILES | O=C(NC(CSC(=O)OCCCO[N+](=O)[O-])C(=O)O)OCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C11H17N3O12S/c15-9(16)8(12-10(17)23-3-1-5-25-13(19)20)7-27-11(18)24-4-2-6-26-14(21)22/h8H,1-7H2,(H,12,17)(H,15,16) |
| InChIKey | GTWBFIAGFCWWOL-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 206.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.33 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|