C15H28N2O8S3 — CID 89160846
(2R)-2-[5-[[(2R)-1,1-dihydroxy-3-(methyldisulfanyl)propan-2-yl]carbamoyloxy]pentoxycarbonylamino]-3-methylsulfanylpropanoic acid (PubChem CID 89160846) has the molecular formula C15H28N2O8S3 and a molecular weight of 460.60 g/mol. Its IUPAC name is (2R)-2-[5-[[(2R)-1,1-dihydroxy-3-(methyldisulfanyl)propan-2-yl]carbamoyloxy]pentoxycarbonylamino]-3-methylsulfanylpropanoic acid.
| Compound Name | (2R)-2-[5-[[(2R)-1,1-dihydroxy-3-(methyldisulfanyl)propan-2-yl]carbamoyloxy]pentoxycarbonylamino]-3-methylsulfanylpropanoic acid |
|---|---|
| PubChem CID | 89160846 |
| Molecular Formula | C15H28N2O8S3 |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | (2R)-2-[5-[[(2R)-1,1-dihydroxy-3-(methyldisulfanyl)propan-2-yl]carbamoyloxy]pentoxycarbonylamino]-3-methylsulfanylpropanoic acid |
| SMILES | CSC[C@H](NC(=O)OCCCCCOC(=O)N[C@@H](CSSC)C(O)O)C(=O)O |
| InChI | InChI=1S/C15H28N2O8S3/c1-26-8-10(12(18)19)16-14(22)24-6-4-3-5-7-25-15(23)17-11(13(20)21)9-28-27-2/h10-11,13,20-21H,3-9H2,1-2H3,(H,16,22)(H,17,23)(H,18,19)/t10-,11-/m0/s1 |
| InChIKey | WSJSWOIKYFSUCX-QWRGUYRKSA-N |
| XLogP | 1.12 |
| TPSA | 154.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|