C15H24N4O13S — CID 59287512
4-nitrooxybutyl 2-(4-nitrooxybutanoylamino)-3-(4-nitrooxybutanoylsulfanyl)propanoate (PubChem CID 59287512) has the molecular formula C15H24N4O13S and a molecular weight of 500.44 g/mol. Its IUPAC name is 4-nitrooxybutyl 2-(4-nitrooxybutanoylamino)-3-(4-nitrooxybutanoylsulfanyl)propanoate.
| Compound Name | 4-nitrooxybutyl 2-(4-nitrooxybutanoylamino)-3-(4-nitrooxybutanoylsulfanyl)propanoate |
|---|---|
| PubChem CID | 59287512 |
| Molecular Formula | C15H24N4O13S |
| Molecular Weight | 500.44 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | 4-nitrooxybutyl 2-(4-nitrooxybutanoylamino)-3-(4-nitrooxybutanoylsulfanyl)propanoate |
| SMILES | O=C(CCCO[N+](=O)[O-])NC(CSC(=O)CCCO[N+](=O)[O-])C(=O)OCCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C15H24N4O13S/c20-13(5-3-9-31-18(25)26)16-12(11-33-14(21)6-4-10-32-19(27)28)15(22)29-7-1-2-8-30-17(23)24/h12H,1-11H2,(H,16,20) |
| InChIKey | HZLLFMPXMAOQHY-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 229.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.44 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|