C19H32N2O7S — CID 58787726
4-nitrooxybutyl (2S)-1-[(2S)-3-hexanoylsulfanyl-2-methylpropanoyl]pyrrolidine-2-carboxylate (PubChem CID 58787726) has the molecular formula C19H32N2O7S and a molecular weight of 432.54 g/mol. Its IUPAC name is 4-nitrooxybutyl (2S)-1-[(2S)-3-hexanoylsulfanyl-2-methylpropanoyl]pyrrolidine-2-carboxylate.
| Compound Name | 4-nitrooxybutyl (2S)-1-[(2S)-3-hexanoylsulfanyl-2-methylpropanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 58787726 |
| Molecular Formula | C19H32N2O7S |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | 4-nitrooxybutyl (2S)-1-[(2S)-3-hexanoylsulfanyl-2-methylpropanoyl]pyrrolidine-2-carboxylate |
| SMILES | CCCCCC(=O)SC[C@@H](C)C(=O)N1CCC[C@H]1C(=O)OCCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C19H32N2O7S/c1-3-4-5-10-17(22)29-14-15(2)18(23)20-11-8-9-16(20)19(24)27-12-6-7-13-28-21(25)26/h15-16H,3-14H2,1-2H3/t15-,16+/m1/s1 |
| InChIKey | RSAODHFMFAMUHU-CVEARBPZSA-N |
| XLogP | 2.99 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|