C25H35N3O8S — CID 58787723
5-nitrooxypentyl (2R)-2-[[(2S)-1-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]pyrrolidine-2-carbonyl]amino]-3-phenylpropanoate (PubChem CID 58787723) has the molecular formula C25H35N3O8S and a molecular weight of 537.64 g/mol. Its IUPAC name is 5-nitrooxypentyl (2R)-2-[[(2S)-1-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]pyrrolidine-2-carbonyl]amino]-3-phenylpropanoate.
| Compound Name | 5-nitrooxypentyl (2R)-2-[[(2S)-1-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]pyrrolidine-2-carbonyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 58787723 |
| Molecular Formula | C25H35N3O8S |
| Molecular Weight | 537.64 g/mol |
| Exact Mass | 537.21 |
| IUPAC Name | 5-nitrooxypentyl (2R)-2-[[(2S)-1-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]pyrrolidine-2-carbonyl]amino]-3-phenylpropanoate |
| SMILES | CC(=O)SC[C@@H](C)C(=O)N1CCC[C@H]1C(=O)N[C@H](Cc1ccccc1)C(=O)OCCCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C25H35N3O8S/c1-18(17-37-19(2)29)24(31)27-13-9-12-22(27)23(30)26-21(16-20-10-5-3-6-11-20)25(32)35-14-7-4-8-15-36-28(33)34/h3,5-6,10-11,18,21-22H,4,7-9,12-17H2,1-2H3,(H,26,30)/t18-,21-,22+/m1/s1 |
| InChIKey | DGIPQPMBSSBCSK-QIJUGHKUSA-N |
| XLogP | 2.54 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.64 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|