C19H24N2O7S — CID 58787757
[4-(nitrooxymethyl)phenyl]methyl (2S)-1-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]pyrrolidine-2-carboxylate (PubChem CID 58787757) has the molecular formula C19H24N2O7S and a molecular weight of 424.48 g/mol. Its IUPAC name is [4-(nitrooxymethyl)phenyl]methyl (2S)-1-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]pyrrolidine-2-carboxylate.
| Compound Name | [4-(nitrooxymethyl)phenyl]methyl (2S)-1-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 58787757 |
| Molecular Formula | C19H24N2O7S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | [4-(nitrooxymethyl)phenyl]methyl (2S)-1-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]pyrrolidine-2-carboxylate |
| SMILES | CC(=O)SC[C@@H](C)C(=O)N1CCC[C@H]1C(=O)OCc1ccc(CO[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H24N2O7S/c1-13(12-29-14(2)22)18(23)20-9-3-4-17(20)19(24)27-10-15-5-7-16(8-6-15)11-28-21(25)26/h5-8,13,17H,3-4,9-12H2,1-2H3/t13-,17+/m1/s1 |
| InChIKey | YVWUZLRPVICEKE-DYVFJYSZSA-N |
| XLogP | 2.34 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|