C29H36N2O6S — CID 88754212
benzyl (2S)-2-[[(2S)-1-(3-acetylsulfanyl-2-methylpropanoyl)pyrrolidine-2-carbonyl]amino]-3-phenylmethoxybutanoate (PubChem CID 88754212) has the molecular formula C29H36N2O6S and a molecular weight of 540.68 g/mol. Its IUPAC name is benzyl (2S)-2-[[(2S)-1-(3-acetylsulfanyl-2-methylpropanoyl)pyrrolidine-2-carbonyl]amino]-3-phenylmethoxybutanoate.
| Compound Name | benzyl (2S)-2-[[(2S)-1-(3-acetylsulfanyl-2-methylpropanoyl)pyrrolidine-2-carbonyl]amino]-3-phenylmethoxybutanoate |
|---|---|
| PubChem CID | 88754212 |
| Molecular Formula | C29H36N2O6S |
| Molecular Weight | 540.68 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | benzyl (2S)-2-[[(2S)-1-(3-acetylsulfanyl-2-methylpropanoyl)pyrrolidine-2-carbonyl]amino]-3-phenylmethoxybutanoate |
| SMILES | CC(=O)SCC(C)C(=O)N1CCC[C@H]1C(=O)N[C@H](C(=O)OCc1ccccc1)C(C)OCc1ccccc1 |
| InChI | InChI=1S/C29H36N2O6S/c1-20(19-38-22(3)32)28(34)31-16-10-15-25(31)27(33)30-26(21(2)36-17-23-11-6-4-7-12-23)29(35)37-18-24-13-8-5-9-14-24/h4-9,11-14,20-21,25-26H,10,15-19H2,1-3H3,(H,30,33)/t20?,21?,25-,26-/m0/s1 |
| InChIKey | PBLMZGRBMNHXOO-LYCIREHVSA-N |
| XLogP | 3.73 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.68 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|