C34H56N4O10S2 — CID 88753377
(2S)-2-[[(2S)-1-(3-acetylsulfanyl-2-methylpropanoyl)pyrrolidine-2-carbonyl]amino]-4-methylpentanoic acid (PubChem CID 88753377) has the molecular formula C34H56N4O10S2 and a molecular weight of 744.97 g/mol. Its IUPAC name is (2S)-2-[[(2S)-1-(3-acetylsulfanyl-2-methylpropanoyl)pyrrolidine-2-carbonyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[(2S)-1-(3-acetylsulfanyl-2-methylpropanoyl)pyrrolidine-2-carbonyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 88753377 |
| Molecular Formula | C34H56N4O10S2 |
| Molecular Weight | 744.97 g/mol |
| Exact Mass | 744.34 |
| IUPAC Name | (2S)-2-[[(2S)-1-(3-acetylsulfanyl-2-methylpropanoyl)pyrrolidine-2-carbonyl]amino]-4-methylpentanoic acid |
| SMILES | CC(=O)SCC(C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CC(C)C)C(=O)O.CC(=O)SCC(C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CC(C)C)C(=O)O |
| InChI | InChI=1S/2C17H28N2O5S/c2*1-10(2)8-13(17(23)24)18-15(21)14-6-5-7-19(14)16(22)11(3)9-25-12(4)20/h2*10-11,13-14H,5-9H2,1-4H3,(H,18,21)(H,23,24)/t2*11?,13-,14-/m00/s1 |
| InChIKey | AFHIMARXXZPZSB-OYAXQXQXSA-N |
| XLogP | 3.02 |
| TPSA | 207.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.97 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|