C13H22N2O3S — CID 14282330
S-[3-[(2S)-2-(ethylcarbamoyl)pyrrolidin-1-yl]-2-methyl-3-oxopropyl] ethanethioate (PubChem CID 14282330) has the molecular formula C13H22N2O3S and a molecular weight of 286.40 g/mol. Its IUPAC name is S-[3-[(2S)-2-(ethylcarbamoyl)pyrrolidin-1-yl]-2-methyl-3-oxopropyl] ethanethioate.
| Compound Name | S-[3-[(2S)-2-(ethylcarbamoyl)pyrrolidin-1-yl]-2-methyl-3-oxopropyl] ethanethioate |
|---|---|
| PubChem CID | 14282330 |
| Molecular Formula | C13H22N2O3S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | S-[3-[(2S)-2-(ethylcarbamoyl)pyrrolidin-1-yl]-2-methyl-3-oxopropyl] ethanethioate |
| SMILES | CCNC(=O)[C@@H]1CCCN1C(=O)C(C)CSC(C)=O |
| InChI | InChI=1S/C13H22N2O3S/c1-4-14-12(17)11-6-5-7-15(11)13(18)9(2)8-19-10(3)16/h9,11H,4-8H2,1-3H3,(H,14,17)/t9?,11-/m0/s1 |
| InChIKey | XDXGIYYHYZNQOE-UMJHXOGRSA-N |
| XLogP | 1.03 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|