C11H18N2O2 — CID 14282316
(2S)-N-ethyl-1-(2-methylprop-2-enoyl)pyrrolidine-2-carboxamide (PubChem CID 14282316) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is (2S)-N-ethyl-1-(2-methylprop-2-enoyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-ethyl-1-(2-methylprop-2-enoyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 14282316 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | (2S)-N-ethyl-1-(2-methylprop-2-enoyl)pyrrolidine-2-carboxamide |
| SMILES | C=C(C)C(=O)N1CCC[C@H]1C(=O)NCC |
| InChI | InChI=1S/C11H18N2O2/c1-4-12-10(14)9-6-5-7-13(9)11(15)8(2)3/h9H,2,4-7H2,1,3H3,(H,12,14)/t9-/m0/s1 |
| InChIKey | IEKRLMKQMMWGCN-VIFPVBQESA-N |
| XLogP | 0.69 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|