C11H22ClN3O2 — CID 119504514
1-acetyl-N-[2-(ethylamino)ethyl]pyrrolidine-2-carboxamide;hydrochloride (PubChem CID 119504514) has the molecular formula C11H22ClN3O2 and a molecular weight of 263.77 g/mol. Its IUPAC name is 1-acetyl-N-[2-(ethylamino)ethyl]pyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | 1-acetyl-N-[2-(ethylamino)ethyl]pyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119504514 |
| Molecular Formula | C11H22ClN3O2 |
| Molecular Weight | 263.77 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 1-acetyl-N-[2-(ethylamino)ethyl]pyrrolidine-2-carboxamide;hydrochloride |
| SMILES | CCNCCNC(=O)C1CCCN1C(C)=O.Cl |
| InChI | InChI=1S/C11H21N3O2.ClH/c1-3-12-6-7-13-11(16)10-5-4-8-14(10)9(2)15;/h10,12H,3-8H2,1-2H3,(H,13,16);1H |
| InChIKey | RTAOKSGFQBLONA-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.77 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|