C20H34ClN3O2 — CID 119508361
1-(adamantane-1-carbonyl)-N-[2-(ethylamino)ethyl]pyrrolidine-2-carboxamide;hydrochloride (PubChem CID 119508361) has the molecular formula C20H34ClN3O2 and a molecular weight of 383.96 g/mol. Its IUPAC name is 1-(adamantane-1-carbonyl)-N-[2-(ethylamino)ethyl]pyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | 1-(adamantane-1-carbonyl)-N-[2-(ethylamino)ethyl]pyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119508361 |
| Molecular Formula | C20H34ClN3O2 |
| Molecular Weight | 383.96 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | 1-(adamantane-1-carbonyl)-N-[2-(ethylamino)ethyl]pyrrolidine-2-carboxamide;hydrochloride |
| SMILES | CCNCCNC(=O)C1CCCN1C(=O)C12CC3CC(CC(C3)C1)C2.Cl |
| InChI | InChI=1S/C20H33N3O2.ClH/c1-2-21-5-6-22-18(24)17-4-3-7-23(17)19(25)20-11-14-8-15(12-20)10-16(9-14)13-20;/h14-17,21H,2-13H2,1H3,(H,22,24);1H |
| InChIKey | PDHQEXWLHVPEBW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.96 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|