C22H32N4O2 — CID 55600339
1-(adamantane-1-carbonyl)-N-(3-pyrazol-1-ylpropyl)pyrrolidine-2-carboxamide (PubChem CID 55600339) has the molecular formula C22H32N4O2 and a molecular weight of 384.52 g/mol. Its IUPAC name is 1-(adamantane-1-carbonyl)-N-(3-pyrazol-1-ylpropyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(adamantane-1-carbonyl)-N-(3-pyrazol-1-ylpropyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 55600339 |
| Molecular Formula | C22H32N4O2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | 1-(adamantane-1-carbonyl)-N-(3-pyrazol-1-ylpropyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(NCCCn1cccn1)C1CCCN1C(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H32N4O2/c27-20(23-5-2-7-25-8-3-6-24-25)19-4-1-9-26(19)21(28)22-13-16-10-17(14-22)12-18(11-16)15-22/h3,6,8,16-19H,1-2,4-5,7,9-15H2,(H,23,27) |
| InChIKey | RGBLAYHOKHOLAK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|