C24H37N3O3 — CID 60569039
1-(adamantane-1-carbonyl)-N-[3-(cyclopentylamino)-3-oxopropyl]pyrrolidine-2-carboxamide (PubChem CID 60569039) has the molecular formula C24H37N3O3 and a molecular weight of 415.58 g/mol. Its IUPAC name is 1-(adamantane-1-carbonyl)-N-[3-(cyclopentylamino)-3-oxopropyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-(adamantane-1-carbonyl)-N-[3-(cyclopentylamino)-3-oxopropyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 60569039 |
| Molecular Formula | C24H37N3O3 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.28 |
| IUPAC Name | 1-(adamantane-1-carbonyl)-N-[3-(cyclopentylamino)-3-oxopropyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(CCNC(=O)C1CCCN1C(=O)C12CC3CC(CC(C3)C1)C2)NC1CCCC1 |
| InChI | InChI=1S/C24H37N3O3/c28-21(26-19-4-1-2-5-19)7-8-25-22(29)20-6-3-9-27(20)23(30)24-13-16-10-17(14-24)12-18(11-16)15-24/h16-20H,1-15H2,(H,25,29)(H,26,28) |
| InChIKey | COOIDSNXGVDBQA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |