C17H25NO3 — CID 7439326
methyl (2S)-1-(adamantane-1-carbonyl)pyrrolidine-2-carboxylate (PubChem CID 7439326) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is methyl (2S)-1-(adamantane-1-carbonyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-(adamantane-1-carbonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 7439326 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | methyl (2S)-1-(adamantane-1-carbonyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCN1C(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H25NO3/c1-21-15(19)14-3-2-4-18(14)16(20)17-8-11-5-12(9-17)7-13(6-11)10-17/h11-14H,2-10H2,1H3/t11?,12?,13?,14-,17?/m0/s1 |
| InChIKey | JUYHWUMTXBZTKZ-ZZTKBFGJSA-N |
| XLogP | 2.37 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |