C9H15BN2O2 — CID 59765360
CID 59765360 (PubChem CID 59765360) has the molecular formula C9H15BN2O2 and a molecular weight of 194.04 g/mol.
| Compound Name | CID 59765360 |
|---|---|
| PubChem CID | 59765360 |
| Molecular Formula | C9H15BN2O2 |
| Molecular Weight | 194.04 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N1CCCC1C(=O)NCCC |
| InChI | InChI=1S/C9H15BN2O2/c1-2-5-11-8(13)7-4-3-6-12(7)9(10)14/h7H,2-6H2,1H3,(H,11,13) |
| InChIKey | TYPYBNWOMHAURQ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.04 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|