C7H13N3O2 — CID 175675318
(2S)-N-ethyl-1-nitrosopyrrolidine-2-carboxamide (PubChem CID 175675318) has the molecular formula C7H13N3O2 and a molecular weight of 171.20 g/mol. Its IUPAC name is (2S)-N-ethyl-1-nitrosopyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-ethyl-1-nitrosopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 175675318 |
| Molecular Formula | C7H13N3O2 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | (2S)-N-ethyl-1-nitrosopyrrolidine-2-carboxamide |
| SMILES | CCNC(=O)[C@@H]1CCCN1N=O |
| InChI | InChI=1S/C7H13N3O2/c1-2-8-7(11)6-4-3-5-10(6)9-12/h6H,2-5H2,1H3,(H,8,11)/t6-/m0/s1 |
| InChIKey | NEZGWSMDKXJDQJ-LURJTMIESA-N |
| XLogP | 0.27 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|