C13H25N5O2 — CID 111117487
1-[2-[bis(ethylamino)methylideneamino]acetyl]-N-methylpyrrolidine-2-carboxamide (PubChem CID 111117487) has the molecular formula C13H25N5O2 and a molecular weight of 283.38 g/mol. Its IUPAC name is 1-[2-[bis(ethylamino)methylideneamino]acetyl]-N-methylpyrrolidine-2-carboxamide.
| Compound Name | 1-[2-[bis(ethylamino)methylideneamino]acetyl]-N-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 111117487 |
| Molecular Formula | C13H25N5O2 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | 1-[2-[bis(ethylamino)methylideneamino]acetyl]-N-methylpyrrolidine-2-carboxamide |
| SMILES | CCNC(=NCC(=O)N1CCCC1C(=O)NC)NCC |
| InChI | InChI=1S/C13H25N5O2/c1-4-15-13(16-5-2)17-9-11(19)18-8-6-7-10(18)12(20)14-3/h10H,4-9H2,1-3H3,(H,14,20)(H2,15,16,17) |
| InChIKey | OAYIVXSGANFWEI-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|