C23H30N4O11S — CID 58787741
[3-(nitrooxymethyl)phenyl] (2S)-1-[(2S)-2-methyl-3-[2-(5-nitrooxypentanoylamino)acetyl]sulfanylpropanoyl]pyrrolidine-2-carboxylate (PubChem CID 58787741) has the molecular formula C23H30N4O11S and a molecular weight of 570.58 g/mol. Its IUPAC name is [3-(nitrooxymethyl)phenyl] (2S)-1-[(2S)-2-methyl-3-[2-(5-nitrooxypentanoylamino)acetyl]sulfanylpropanoyl]pyrrolidine-2-carboxylate.
| Compound Name | [3-(nitrooxymethyl)phenyl] (2S)-1-[(2S)-2-methyl-3-[2-(5-nitrooxypentanoylamino)acetyl]sulfanylpropanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 58787741 |
| Molecular Formula | C23H30N4O11S |
| Molecular Weight | 570.58 g/mol |
| Exact Mass | 570.16 |
| IUPAC Name | [3-(nitrooxymethyl)phenyl] (2S)-1-[(2S)-2-methyl-3-[2-(5-nitrooxypentanoylamino)acetyl]sulfanylpropanoyl]pyrrolidine-2-carboxylate |
| SMILES | C[C@H](CSC(=O)CNC(=O)CCCCO[N+](=O)[O-])C(=O)N1CCC[C@H]1C(=O)Oc1cccc(CO[N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H30N4O11S/c1-16(15-39-21(29)13-24-20(28)9-2-3-11-36-26(32)33)22(30)25-10-5-8-19(25)23(31)38-18-7-4-6-17(12-18)14-37-27(34)35/h4,6-7,12,16,19H,2-3,5,8-11,13-15H2,1H3,(H,24,28)/t16-,19+/m1/s1 |
| InChIKey | ZMBYYTLPWRYBOQ-APWZRJJASA-N |
| XLogP | 1.68 |
| TPSA | 197.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.58 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|