C20H32N4O11S — CID 58787756
4-nitrooxybutyl (2S)-1-[(2S)-2-methyl-3-[2-(5-nitrooxypentanoylamino)acetyl]sulfanylpropanoyl]pyrrolidine-2-carboxylate (PubChem CID 58787756) has the molecular formula C20H32N4O11S and a molecular weight of 536.56 g/mol. Its IUPAC name is 4-nitrooxybutyl (2S)-1-[(2S)-2-methyl-3-[2-(5-nitrooxypentanoylamino)acetyl]sulfanylpropanoyl]pyrrolidine-2-carboxylate.
| Compound Name | 4-nitrooxybutyl (2S)-1-[(2S)-2-methyl-3-[2-(5-nitrooxypentanoylamino)acetyl]sulfanylpropanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 58787756 |
| Molecular Formula | C20H32N4O11S |
| Molecular Weight | 536.56 g/mol |
| Exact Mass | 536.18 |
| IUPAC Name | 4-nitrooxybutyl (2S)-1-[(2S)-2-methyl-3-[2-(5-nitrooxypentanoylamino)acetyl]sulfanylpropanoyl]pyrrolidine-2-carboxylate |
| SMILES | C[C@H](CSC(=O)CNC(=O)CCCCO[N+](=O)[O-])C(=O)N1CCC[C@H]1C(=O)OCCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C20H32N4O11S/c1-15(14-36-18(26)13-21-17(25)8-2-3-11-34-23(29)30)19(27)22-9-6-7-16(22)20(28)33-10-4-5-12-35-24(31)32/h15-16H,2-14H2,1H3,(H,21,25)/t15-,16+/m1/s1 |
| InChIKey | SHFAGSSHSUHBHD-CVEARBPZSA-N |
| XLogP | 0.90 |
| TPSA | 197.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.56 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|