C13H21N3O9S2 — CID 10180899
methyl 1-[3-(2,3-dinitrooxypropyldisulfanyl)-2-methylpropanoyl]pyrrolidine-2-carboxylate (PubChem CID 10180899) has the molecular formula C13H21N3O9S2 and a molecular weight of 427.46 g/mol. Its IUPAC name is methyl 1-[3-(2,3-dinitrooxypropyldisulfanyl)-2-methylpropanoyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl 1-[3-(2,3-dinitrooxypropyldisulfanyl)-2-methylpropanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 10180899 |
| Molecular Formula | C13H21N3O9S2 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | methyl 1-[3-(2,3-dinitrooxypropyldisulfanyl)-2-methylpropanoyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CCCN1C(=O)C(C)CSSCC(CO[N+](=O)[O-])O[N+](=O)[O-] |
| InChI | InChI=1S/C13H21N3O9S2/c1-9(12(17)14-5-3-4-11(14)13(18)23-2)7-26-27-8-10(25-16(21)22)6-24-15(19)20/h9-11H,3-8H2,1-2H3 |
| InChIKey | XXYNIFUHTSNDJQ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 151.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|