C15H27N3O9S2 — CID 143199720
ethane;methyl 1-[3-(2,3-dinitrooxypropyldisulfanyl)-2-methylpropanoyl]pyrrolidine-2-carboxylate (PubChem CID 143199720) has the molecular formula C15H27N3O9S2 and a molecular weight of 457.53 g/mol. Its IUPAC name is ethane;methyl 1-[3-(2,3-dinitrooxypropyldisulfanyl)-2-methylpropanoyl]pyrrolidine-2-carboxylate.
| Compound Name | ethane;methyl 1-[3-(2,3-dinitrooxypropyldisulfanyl)-2-methylpropanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 143199720 |
| Molecular Formula | C15H27N3O9S2 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | ethane;methyl 1-[3-(2,3-dinitrooxypropyldisulfanyl)-2-methylpropanoyl]pyrrolidine-2-carboxylate |
| SMILES | CC.COC(=O)C1CCCN1C(=O)C(C)CSSCC(CO[N+](=O)[O-])O[N+](=O)[O-] |
| InChI | InChI=1S/C13H21N3O9S2.C2H6/c1-9(12(17)14-5-3-4-11(14)13(18)23-2)7-26-27-8-10(25-16(21)22)6-24-15(19)20;1-2/h9-11H,3-8H2,1-2H3;1-2H3 |
| InChIKey | YDPJGUZSRFNORA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 151.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|