C17H22N2O7 — CID 59287490
1-O-tert-butyl 2-O-[3-(nitrooxymethyl)phenyl] pyrrolidine-1,2-dicarboxylate (PubChem CID 59287490) has the molecular formula C17H22N2O7 and a molecular weight of 366.37 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-[3-(nitrooxymethyl)phenyl] pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-[3-(nitrooxymethyl)phenyl] pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 59287490 |
| Molecular Formula | C17H22N2O7 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 1-O-tert-butyl 2-O-[3-(nitrooxymethyl)phenyl] pyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1C(=O)Oc1cccc(CO[N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H22N2O7/c1-17(2,3)26-16(21)18-9-5-8-14(18)15(20)25-13-7-4-6-12(10-13)11-24-19(22)23/h4,6-7,10,14H,5,8-9,11H2,1-3H3 |
| InChIKey | VPHZCWRJOJNSTN-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|