C17H20N2O4 — CID 164666077
1-O-tert-butyl 2-O-(4-cyanophenyl) (2S)-pyrrolidine-1,2-dicarboxylate (PubChem CID 164666077) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-(4-cyanophenyl) (2S)-pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-(4-cyanophenyl) (2S)-pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 164666077 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 1-O-tert-butyl 2-O-(4-cyanophenyl) (2S)-pyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)Oc1ccc(C#N)cc1 |
| InChI | InChI=1S/C17H20N2O4/c1-17(2,3)23-16(21)19-10-4-5-14(19)15(20)22-13-8-6-12(11-18)7-9-13/h6-9,14H,4-5,10H2,1-3H3/t14-/m0/s1 |
| InChIKey | NWOBCZRTTIDTFE-AWEZNQCLSA-N |
| XLogP | 2.86 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|